CAS 2245-52-5

(4-ethenylphenyl)-N,N-dimethylmethanaminium

Description:

(4-Ethenylphenyl)-N,N-dimethylmethanaminium, with the CAS number 2245-52-5, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a vinyl group attached to a phenyl ring, which contributes to its reactivity and potential applications in polymer chemistry, particularly in the synthesis of cationic polymers. The dimethyl groups on the nitrogen enhance its solubility in polar solvents and can influence its interaction with anionic species. As a quaternary ammonium salt, it exhibits surfactant properties, making it useful in various formulations, including disinfectants and antimicrobial agents. The presence of the vinyl group also suggests potential for polymerization reactions, allowing it to be incorporated into larger macromolecular structures. Overall, this compound's unique structure imparts specific chemical properties that can be exploited in industrial and research applications, particularly in materials science and organic synthesis.

Formula: C₁₁H₁₆N

InChI: InChI=1/C11H15N/c1-4-10-5-7-11(8-6-10)9-12(2)3/h4-8H,1,9H2,2-3H3/p+1

4-Ethenyl-N,N-dimethylbenzenemethanamine

CAS: 2245-52-5

Formula: C₁₁H₁₅N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 161.2435

Ref: IN-DA00BBP5

N,N-Dimethyl-1-(4-vinylphenyl)methanamine

CAS: 2245-52-5

N,N-Dimethyl-1-(4-vinylphenyl)methanamine

Purity: 95%,stabilized with 500ppm TBC

Molecular weight: 161.24g/mol

Ref: 54-OR76065

N,N-Dimethyl-1-(4-vinylphenyl)methanamine

CAS: 2245-52-5

Purity: 98% (stabilized with TBC)

Molecular weight: 161.2480011

Ref: 10-F720407