CymitQuimica logo

CAS 2245694-97-5

:

N-[2-(2-Chlorobenzoyl)-4-nitrophenyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide

Description:
N-[2-(2-Chlorobenzoyl)-4-nitrophenyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide is a synthetic organic compound characterized by its complex structure, which includes an isoindole core, a dioxo group, and various functional groups such as a chlorobenzoyl and nitrophenyl moiety. This compound typically exhibits properties associated with its aromatic and heterocyclic components, including potential biological activity and solubility characteristics influenced by the presence of polar functional groups. The chlorobenzoyl group may impart lipophilicity, while the nitro group can enhance reactivity and potential interactions with biological targets. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to elucidate its full range of physical and chemical properties, as well as its potential applications in research or industry.
Formula:C23H14ClN3O6
InChI:InChI=1S/C23H14ClN3O6/c24-18-8-4-3-7-16(18)21(29)17-11-13(27(32)33)9-10-19(17)25-20(28)12-26-22(30)14-5-1-2-6-15(14)23(26)31/h1-11H,12H2,(H,25,28)
InChI key:InChIKey=WPBZEZREZYZXDI-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(NC(CN2C(=O)C=3C(C2=O)=CC=CC3)=O)C=CC(N(=O)=O)=C1)C4=C(Cl)C=CC=C4
Synonyms:
  • 2H-Isoindole-2-acetamide, N-[2-(2-chlorobenzoyl)-4-nitrophenyl]-1,3-dihydro-1,3-dioxo-
  • N-[2-(2-Chlorobenzoyl)-4-nitrophenyl]-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.