CymitQuimica logo

CAS 224584-18-3

:

3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid

Description:
3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid is a bicyclic compound characterized by its unique bicyclo[1.1.1]pentane structure, which consists of a rigid framework of carbon atoms. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and interactions with biological systems. The carboxylic acid functional group (-COOH) contributes to its acidity and polar character, making it soluble in polar solvents. This compound may exhibit interesting properties such as high thermal stability and unique reactivity due to the steric and electronic effects of the trifluoromethyl group. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of pharmaceuticals, where the trifluoromethyl group is often associated with increased metabolic stability and bioactivity. Overall, 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and applications.
Formula:C7H7F3O2
InChI:InChI=1S/C7H7F3O2/c8-7(9,10)6-1-5(2-6,3-6)4(11)12/h1-3H2,(H,11,12)
InChI key:InChIKey=CGISBZCYXGUFNK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C12CC(C(O)=O)(C1)C2
Synonyms:
  • 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid
  • 3-(Trifluoromethyl)bicyclo[1.1.1]pentan-1-carboxylicacid
  • Bicyclo[1.1.1]pentane-1-carboxylic acid, 3-(trifluoromethyl)-
  • 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid(WXFC0807)
  • 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylicacid
Found 5 products.