CAS 22461-89-8
:3-ethylcyclohexanone
Description:
3-Ethylcyclohexanone is a cyclic ketone characterized by a cyclohexane ring with an ethyl group attached to the third carbon and a ketone functional group at the carbon adjacent to the ethyl group. Its molecular formula is C9H16O, indicating it contains nine carbon atoms, sixteen hydrogen atoms, and one oxygen atom. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the carbonyl group. 3-Ethylcyclohexanone is used in organic synthesis and as an intermediate in the production of various chemicals, including fragrances and pharmaceuticals. Its boiling point and melting point are influenced by the molecular structure, and it is generally stable under standard conditions. However, like many organic solvents, it should be handled with care due to potential health hazards, including irritation to the skin and respiratory system. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C8H14O
InChI:InChI=1/C8H14O/c1-2-7-4-3-5-8(9)6-7/h7H,2-6H2,1H3
SMILES:CCC1CCCC(=O)C1
Synonyms:- Cyclohexanone, 3-ethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Ethylcyclohexan-1-one
CAS:<p>3-Ethylcyclohexan-1-one is a reactive, organic compound with the chemical formula C9H12O. It is a colorless liquid that has a sweet odor similar to vanilla. 3-Ethylcyclohexan-1-one has been shown to react with amines, alcohols, and phenols. The rate of reaction increases as the number of hydroxyl groups in the molecule increases. This compound is commonly used as an organic solvent and as a catalyst in organic synthesis reactions.</p>Formula:C8H14OPurity:Min. 95%Molecular weight:126.2 g/mol
