CAS 22462-34-6
:4-chloro-5-fluoropyrimidin-2-ol
Description:
4-Chloro-5-fluoropyrimidin-2-ol is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both chlorine and fluorine substituents. The presence of the hydroxyl group (-OH) at the 2-position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The chlorine and fluorine atoms introduce unique electronic properties, potentially enhancing the compound's biological activity and stability. 4-Chloro-5-fluoropyrimidin-2-ol may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, particularly in the development of antiviral or anticancer agents. Its molecular structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C4H2ClFN2O
InChI:InChI=1/C4H2ClFN2O/c5-3-2(6)1-7-4(9)8-3/h1H,(H,7,8,9)
SMILES:c1c(c(Cl)nc(n1)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
