
CAS 224626-08-8
:1-[(2R)-3-(Acetylthio)-2-methyl-1-oxopropyl]-D-proline
Description:
1-[(2R)-3-(Acetylthio)-2-methyl-1-oxopropyl]-D-proline, with the CAS number 224626-08-8, is a synthetic compound that belongs to the class of proline derivatives. This substance features a proline backbone, which is an amino acid known for its role in protein structure and function. The presence of an acetylthio group indicates that it has a thioester functional group, which can influence its reactivity and biological activity. The specific stereochemistry at the 2-position (2R) suggests that it has a defined spatial arrangement, which is crucial for its interaction with biological targets. This compound may exhibit properties such as solubility in polar solvents, potential biological activity, and the ability to participate in various chemical reactions due to its functional groups. Its unique structure may make it of interest in medicinal chemistry, particularly in the design of pharmaceuticals or as a biochemical probe. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H17NO4S
InChI:InChI=1S/C11H17NO4S/c1-7(6-17-8(2)13)10(14)12-5-3-4-9(12)11(15)16/h7,9H,3-6H2,1-2H3,(H,15,16)/t7-,9+/m0/s1
InChI key:InChIKey=ZNQRGUYIKSRYCI-IONNQARKSA-N
SMILES:C([C@H](CSC(C)=O)C)(=O)N1[C@@H](C(O)=O)CCC1
Synonyms:- D-Proline, 1-[(2R)-3-(acetylthio)-2-methyl-1-oxopropyl]-
- 1-[(2R)-3-(Acetylthio)-2-methyl-1-oxopropyl]-D-proline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
