CAS 224635-22-7

Ethyl 5-amino-2-pyridinepropanoate

Description:

Ethyl 5-amino-2-pyridinepropanoate, identified by its CAS number 224635-22-7, is an organic compound characterized by its pyridine ring structure, which contributes to its chemical properties and reactivity. This compound features an ethyl ester functional group, which typically enhances its solubility in organic solvents and may influence its biological activity. The presence of the amino group at the 5-position of the pyridine ring suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic substitutions. Ethyl 5-amino-2-pyridinepropanoate may exhibit properties such as moderate polarity, making it suitable for applications in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on concentration and exposure levels.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1S/C10H14N2O2/c1-2-14-10(13)6-5-9-4-3-8(11)7-12-9/h3-4,7H,2,5-6,11H2,1H3

InChI key: InChIKey=JPZMBHLSKTVDRF-UHFFFAOYSA-N

SMILES: C(CC(OCC)=O)C1=CC=C(N)C=N1

Synonyms:

• 2-Pyridinepropanoic acid, 5-amino-, ethyl ester
• Ethyl 5-amino-2-pyridinepropanoate

Ethyl 3-(5-aminopyridin-2-yl)propanoate

CAS: 224635-22-7

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 194.2 g/mol

Ref: 3D-ZIA63522