CymitQuimica logo

CAS 2246553-09-1

:

1-(tert-Butoxycarbonyl)indolin-6-yl-6-boronic acid

Description:
1-(tert-Butoxycarbonyl)indolin-6-yl-6-boronic acid is a chemical compound characterized by its boronic acid functionality, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the tert-butoxycarbonyl (Boc) group provides protection for the amine functionality, facilitating selective reactions. This compound features an indoline structure, which contributes to its potential biological activity and interaction with various biological targets. The boronic acid moiety enhances its reactivity in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is pivotal in the formation of carbon-carbon bonds. Additionally, the compound's solubility and stability can be influenced by the presence of the Boc group and the boronic acid, making it suitable for various synthetic pathways. Overall, 1-(tert-Butoxycarbonyl)indolin-6-yl-6-boronic acid is a versatile building block in organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C13H18BNO4
InChI:InChI=1S/C13H18BNO4/c1-13(2,3)19-12(16)15-7-6-9-4-5-10(14(17)18)8-11(9)15/h4-5,8,17-18H,6-7H2,1-3H3
InChI key:MYIBUIVBMRTSDF-UHFFFAOYSA-N
SMILES:B(C1=CC2=C(CCN2C(=O)OC(C)(C)C)C=C1)(O)O
Synonyms:
  • 1-(tert-Butoxycarbonyl)indolin-6-yl-6-boronic acid
  • 1-(tert-Butoxycarbonyl)indolin-6-yl-6-boronic acid(contains varying amounts of Anhydride)
Found 4 products.