CAS 22477-85-6: Micromeric acid

Description:Micromeric acid, with the CAS number 22477-85-6, is a chemical compound that belongs to the class of organic acids. It is characterized by its unique molecular structure, which includes functional groups that contribute to its acidic properties. Typically, micromeric acid exhibits solubility in polar solvents, making it useful in various chemical applications. Its acidity can influence its reactivity, allowing it to participate in various chemical reactions, such as esterification or neutralization. The compound may also have specific applications in pharmaceuticals, agrochemicals, or as a reagent in organic synthesis. Additionally, micromeric acid's physical properties, such as melting point, boiling point, and density, can vary based on its purity and the presence of other substances. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage in laboratory or industrial settings. Overall, micromeric acid is a versatile compound with potential applications across multiple fields of chemistry.

Formula:C₃₀H₄₆O₃

InChI:InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,19,21-24,31H,1,9-17H2,2-7H3,(H,32,33)/t19-,21-,22+,23-,24-,27-,28+,29+,30-/m0/s1

InChI key:InChIKey=RSYAFUAKPCXDDM-SSMFGXPISA-N

SMILES:O=C(O)C12CCC(=C)C(C)C2C3=CCC4C5(C)CCC(O)C(C)(C)C5CCC4(C)C3(C)CC1