CAS 22478-90-6: 5-benzyl-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:5-Benzyl-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole framework. The presence of benzyl and phenyl groups contributes to its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, due to their ability to interact with biological systems. Additionally, the compound's stability and reactivity can be influenced by the substituents on the triazole ring, which may affect its synthesis and potential uses. Overall, 5-benzyl-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione represents a class of compounds with diverse applications based on their chemical properties.
Formula:C15H13N3S
InChI:InChI=1/C15H13N3S/c19-15-17-16-14(11-12-7-3-1-4-8-12)18(15)13-9-5-2-6-10-13/h1-10H,11H2,(H,17,19)
- Synonyms:
- 3-benzyl-4-phenyl-4,5-dihydro-1H-1,2,4-triazole-5-thione
- 4H-1,2,4-Triazole-3-thiol, 4-phenyl-5-(phenylmethyl)-
- 5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-BENZYL-4-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL REF: IN-DA00BEQNCAS: 22478-90-6 | - - - | To inquire | Mon 05 May 25 |
 | 5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol REF: 54-OR14453CAS: 22478-90-6 | - - - | To inquire | Mon 12 May 25 |
 | 5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol REF: 10-F039261CAS: 22478-90-6 | - - - | To inquire | Tue 13 May 25 |
 | 5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol REF: 3D-FB132763CAS: 22478-90-6 | Min. 95% | - - - | Discontinued product |
Ref: 54-OR14453
| Undefined size | To inquire |
Ref: 10-F039261
| 1g | To inquire | ||
| 5g | To inquire |
5-Benzyl-4-phenyl-4H-1,2,4-triazole-3-thiol
Ref: 3D-FB132763
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
