CAS 22478-95-1
:Ethanesulfonic acid, compd. with 3-[[[3-chloro-4-[3-(2,4,6-triamino-5-pyrimidinyl)propoxy]phenyl]amino]carbonyl]benzenesulfonyl fluoride (1:1)
Description:
Ethanesulfonic acid, in combination with the specified compound, is a complex chemical substance characterized by its sulfonic acid functional group, which imparts strong acidity and solubility in water. The compound features a multi-functional structure, including a chloro-substituted phenyl group and a pyrimidine moiety with multiple amino groups, suggesting potential biological activity. The presence of a sulfonyl fluoride group indicates reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit properties such as high polarity and the ability to form hydrogen bonds due to the presence of amino groups. Its intricate structure suggests potential applications in pharmaceuticals or as a biochemical reagent, although specific applications would depend on further research into its biological interactions and stability. Overall, the compound's unique characteristics stem from its diverse functional groups, which contribute to its chemical reactivity and potential utility in various scientific fields.
Formula:C20H20ClFN6O4S·C2H6O3S
InChI:InChI=1S/C20H20ClFN6O4S.C2H6O3S/c21-15-10-12(26-19(29)11-3-1-4-13(9-11)33(22,30)31)6-7-16(15)32-8-2-5-14-17(23)27-20(25)28-18(14)24;1-2-6(3,4)5/h1,3-4,6-7,9-10H,2,5,8H2,(H,26,29)(H6,23,24,25,27,28);2H2,1H3,(H,3,4,5)
InChI key:InChIKey=PBVSJONUWIGRKU-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=C(OCCCC=2C(N)=NC(N)=NC2N)C=C1)(=O)C3=CC(S(F)(=O)=O)=CC=C3.S(CC)(=O)(=O)O
Synonyms:- Ethanesulfonic acid, compd. with m-[[3-chloro-4-[3-(2,4,6-triamino-5-pyrimidinyl)propoxy]phenyl]carbamoyl]benzenesulfonyl fluoride (1:1)
- Benzenesulfonyl fluoride, m-[[3-chloro-4-[3-(2,4,6-triamino-5-pyrimidinyl)propoxy]phenyl]carbamoyl]-, monoethanesulfonate
- NSC 114923
- Ethanesulfonic acid, compd. with 3-[[[3-chloro-4-[3-(2,4,6-triamino-5-pyrimidinyl)propoxy]phenyl]amino]carbonyl]benzenesulfonyl fluoride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-((3-Chloro-4-(3-(2,4,6-triamino-5-pyrimidinyl)propoxy)phenyl)carbamoyl)benzenesulfonyl fluoride monoethanesulfonate
CAS:m-((3-Chloro-4-(3-(2,4,6-triamino-5-pyrimidinyl)propoxy)phenyl)carbamoyl)benzenesulfonyl fluoride monoethanesulfonate can be used in related research in theFormula:C22H26ClFN6O7S2Color and Shape:SolidMolecular weight:605.06
