CAS 2248-73-9

2′-Deoxy-5-fluoro-N-methylcytidine

Description:

2′-Deoxy-5-fluoro-N-methylcytidine is a nucleoside analog that is structurally related to cytidine, featuring a fluorine atom at the 5-position of the pyrimidine ring and a methyl group attached to the nitrogen at the 1-position. This modification enhances its stability and bioactivity, making it of interest in medicinal chemistry, particularly in the development of antiviral and anticancer agents. The presence of the fluorine atom can influence the compound's ability to interact with nucleic acid targets, potentially altering its pharmacological properties. As a deoxynucleoside, it is incorporated into DNA, where it may interfere with normal replication and transcription processes. The compound is typically studied for its effects on cellular mechanisms and its potential therapeutic applications. Its CAS number, 2248-73-9, is a unique identifier that facilitates the tracking and referencing of this specific chemical in scientific literature and databases. Overall, 2′-Deoxy-5-fluoro-N-methylcytidine represents a significant compound in the field of nucleoside analog research.

Formula: C₁₀H₁₄FN₃O₄

InChI: InChI=1S/C10H14FN3O4/c1-12-9-5(11)3-14(10(17)13-9)8-2-6(16)7(4-15)18-8/h3,6-8,15-16H,2,4H2,1H3,(H,12,13,17)/t6-,7+,8+/m0/s1

InChI key: InChIKey=SPWIGPQVICYSOT-XLPZGREQSA-N

SMILES: O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=C(F)C(NC)=N1

Synonyms:

• Cytidine, 2′-deoxy-5-fluoro-N-methyl-
• 2′-Deoxy-5-fluoro-N-methylcytidine

2'-Deoxy-5-fluoro-N-methylcytidine

CAS: 2248-73-9

2'-Deoxy-5-fluoro-N-methylcytidine is a phosphoramidite that belongs to the group of deoxyribonucleosides. It is used as an antiviral agent, with high purity and high quality. 2'-Deoxy-5-fluoro-N-methylcytidine has been shown to inhibit the growth of cancer cells and is also a novel nucleoside with anticancer activity.

Formula: C₁₀H₁₄FN₃O₄

Purity: Min. 95%

Molecular weight: 259.23 g/mol

Ref: 3D-ND82161