CAS 22480-91-7
:2,3,4-Trimethoxybenzeneacetic acid
Description:
2,3,4-Trimethoxybenzeneacetic acid, with the CAS number 22480-91-7, is an organic compound characterized by its aromatic structure and the presence of three methoxy (-OCH3) groups attached to a benzene ring, along with an acetic acid functional group. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in organic solvents and potential reactivity due to the carboxylic acid group. The methoxy groups can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, the presence of multiple methoxy groups may affect the compound's polarity and hydrogen bonding capabilities, which can influence its behavior in biological systems and its interactions with other molecules. While specific applications may vary, compounds with similar structures are often investigated for their potential pharmaceutical properties, including anti-inflammatory or antioxidant activities. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C11H14O5
InChI:InChI=1S/C11H14O5/c1-14-8-5-4-7(6-9(12)13)10(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13)
InChI key:InChIKey=ZMWCKCLDAQWIDA-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC=C1CC(O)=O
Synonyms:- (2,3,4-Trimethoxyphenyl)Acetate
- 2,3,4-Trimethoxybenzeneacetic acid
- 2,3,4-Trimethoxyphenylacetic acid
- 2-(2,3,4-Trimethoxyphenyl)acetic acid
- Acetic acid, (2,3,4-trimethoxyphenyl)-
- Benzeneacetic acid, 2,3,4-trimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2,3,4-Trimethoxyphenyl)acetic acid
CAS:Formula:C11H14O5Color and Shape:SolidMolecular weight:226.22592,3,4-Trimethoxyphenylacetic acid
CAS:2,3,4-Trimethoxyphenylacetic acid
Molecular weight:226.22586g/mol(2,3,4-Trimethoxyphenyl)acetic acid
CAS:(2,3,4-Trimethoxyphenyl)acetic acid is a potent compound that binds to the 5-ht7 receptor. It has been shown to inhibit the binding of 5-HT to the 5-HT1A and 5-HT7 receptors. This drug has also been shown to have affinity for the receptor and may be used in the treatment of depression, anxiety, and other mood disorders.Formula:C11H14O5Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:226.23 g/mol2,3,4-Trimethoxyphenylacetic acid
CAS:Formula:C11H14O5Purity:98.0%Color and Shape:SolidMolecular weight:226.228




