CAS 22485-08-1

1,3,4,14b-Tetrahydro-2,7-dimethyl-2H-dibenzo[b,f]pyrazino[1,2-d][1,4]oxazepine

Description:

1,3,4,14b-Tetrahydro-2,7-dimethyl-2H-dibenzo[b,f]pyrazino[1,2-d][1,4]oxazepine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrazine and oxazepine moieties. This compound features a fused ring system that contributes to its potential biological activity. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The compound's structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. Its specific stereochemistry and functional groups may also play a crucial role in determining its pharmacological properties. As with many organic compounds, the stability, reactivity, and interactions of this substance can be influenced by environmental factors such as pH and temperature. Further research is necessary to fully elucidate its properties and potential applications in various fields, including drug development and materials science.

Formula: C₁₈H₂₀N₂O

InChI: InChI=1S/C18H20N2O/c1-13-7-8-18-15(11-13)20-10-9-19(2)12-16(20)14-5-3-4-6-17(14)21-18/h3-8,11,16H,9-10,12H2,1-2H3

InChI key: InChIKey=AQCUOHAOVDYWGZ-UHFFFAOYSA-N

SMILES: CN1CC2N(C=3C(OC=4C2=CC=CC4)=CC=C(C)C3)CC1

Synonyms:

• 1,3,4,14b-Tetrahydro-2,7-dimethyl-2H-dibenzo[b,f]pyrazino[1,2-d][1,4]oxazepine
• 2H-Dibenzo[b,f]pyrazino[1,2-d][1,4]oxazepine, 1,3,4,14b-tetrahydro-2,7-dimethyl-

Org GC 94

CAS: 22485-08-1

Org GC 94 is a serotonin antagonist; anti-migraine.

Formula: C₁₈H₂₀N₂O

Purity: 99.57%

Color and Shape: Solid

Molecular weight: 280.36

Ref: TM-T69734