CAS 225-51-4: Benz[c]acridine

Description:Benz[c]acridine is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of multiple aromatic rings. It is known for its planar geometry, which contributes to its stability and potential for intercalation into DNA. This compound is typically a solid at room temperature and exhibits a high melting point. Benz[c]acridine is recognized for its fluorescence properties, making it of interest in various applications, including organic electronics and photonics. However, it is also noted for its potential mutagenic and carcinogenic effects, which raises concerns regarding its environmental and health impacts. The compound is poorly soluble in water but soluble in organic solvents, which influences its behavior in biological systems and environmental contexts. Due to its structural similarity to other PAHs, it may share similar pathways of metabolism and toxicity. As with many PAHs, the presence of Benz[c]acridine in the environment is often associated with incomplete combustion processes, making it a subject of study in environmental chemistry and toxicology.

Formula:C₁₇H₁₁N

InChI:InChI=1S/C17H11N/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)18-17(14)15/h1-11H

InChI key:InChIKey=OAPPEBNXKAKQGS-UHFFFAOYSA-N

SMILES:N=1C=2C=CC=CC2C=C3C=CC=4C=CC=CC4C13