CAS 22503-72-6
:7-chloro-3-methyl-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide
Description:
7-Chloro-3-methyl-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide, identified by its CAS number 22503-72-6, is a chemical compound that belongs to the class of benzothiadiazines. This substance features a bicyclic structure that incorporates a thiadiazine ring fused to a benzene ring, which contributes to its unique chemical properties. The presence of a chlorine atom at the 7-position and a methyl group at the 3-position enhances its reactivity and solubility in various organic solvents. The 1,1-dioxide functional group indicates the presence of two oxygen atoms bonded to the sulfur atom, which can influence the compound's biological activity and stability. This compound is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit properties such as anti-inflammatory or diuretic effects. Its specific characteristics, including melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances.
Formula:C8H9ClN2O2S
InChI:InChI=1S/C8H9ClN2O2S/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5/h2-5,10-11H,1H3
InChI key:InChIKey=VZRNTCHTJRLTMU-UHFFFAOYSA-N
SMILES:O=S1(=O)C=2C(NC(C)N1)=CC=C(Cl)C2
Synonyms:- 2H-1,2,4-Benzothiadiazine, 7-chloro-3,4-dihydro-3-methyl-, 1,1-dioxide
- 7-Chloro-3,4-dihydro-3-methyl-2H-1,2,4-benzothiadiazine 1,1-dioxide
- 7-Chloro-3-methyl-3,4-dihydro-2H-1,2,4-benzothiadiazine-S,S-dioxide
- Idra 21
- 7-Chloro-3-methyl-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Chloro-3-methyl-3,4-dihydro-2H-benzo[e][1,2,4]thiadiazine 1,1-dioxide
CAS:Formula:C8H9ClN2O2SPurity:97%Color and Shape:SolidMolecular weight:232.68737-Chloro-3-Methyl-3,4-Dihydro-2H-1,2,4-Benzothiadiazine 1,1-Dioxide
CAS:7-Chloro-3-Methyl-3,4-Dihydro-2H-1,2,4-Benzothiadiazine 1,1-DioxidePurity:99%Molecular weight:232.69g/molIDRA-21
CAS:IDRA-21 is a positive AMPA receptor modulator.Formula:C8H9ClN2O2SPurity:99.73%Color and Shape:SolidMolecular weight:232.69IDRA-21
CAS:Controlled Product<p>Applications IDRA-21 is a benzothiadiazine derivative and a positive allosteric modulator of glutamate AMPA receptors (1,2,3,4). It is able to increase excitatory synaptic strength by inhibiting AMPA receptor desensitization. IDRA 21 may exhibit therapeutic effects to ameliorate memory deficits in patients with cognitive impairments such as Alzheimer's disease.<br>References (1) Malkova, L, et al.: Neuropharmacology. 60, 1262 (2011)(2) Dingledine, R., et al.: Pharmacol. Rev., 51, 7 (1999)(3) Sun, Y., et al.: Nature, 417, 245 (2002) (4) Thomsen, R., et al.: J. Med. Chem., 49, 3315 (2006)<br></p>Formula:C8H9ClN2O2SColor and Shape:NeatMolecular weight:232.69



