CymitQuimica logo

CAS 22503-74-8

:

2H-1,2,4-Benzothiadiazine, 7-chloro-3,4-dihydro-, 1,1-dioxide

Description:
2H-1,2,4-Benzothiadiazine, 7-chloro-3,4-dihydro-, 1,1-dioxide, commonly referred to as a benzothiadiazine derivative, is a chemical compound characterized by its bicyclic structure that includes a benzene ring fused to a thiadiazine ring. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents. It is known for its potential applications in various fields, including pharmaceuticals, where it may act as a diuretic or antihypertensive agent. The presence of the chlorine atom and the sulfonyl group (dioxide) contributes to its reactivity and biological activity. Additionally, this compound may undergo various chemical reactions, including substitution and oxidation, which can be leveraged in synthetic chemistry. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structural features and functional groups make it a subject of interest in medicinal chemistry and related research areas.
Formula:C7H7ClN2O2S
InChI:InChI=1S/C7H7ClN2O2S/c8-5-1-2-6-7(3-5)13(11,12)10-4-9-6/h1-3,9-10H,4H2
InChI key:InChIKey=UDFVPYLRSLZQGZ-UHFFFAOYSA-N
SMILES:O=S1(=O)C=2C(NCN1)=CC=C(Cl)C2
Synonyms:
  • 2H-1,2,4-Benzothiadiazine, 7-chloro-3,4-dihydro-, 1,1-dioxide
  • 7-Chloro-3,4-dihydro-2H-1,2,4-benzothiadiazine-1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.