CAS 22506-13-4

5-[(diethylamino)methyl]quinolin-8-ol

Description:

5-[(Diethylamino)methyl]quinolin-8-ol, with the CAS number 22506-13-4, is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a hydroxyl group (-OH) at the 8-position and a diethylamino group at the 5-position, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits solubility in organic solvents, while its solubility in water may vary depending on pH. The presence of the hydroxyl group allows for potential hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential applications in dye synthesis, as well as in the development of pharmaceuticals due to its ability to interact with biological targets. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₄H₁₈N₂O

InChI: InChI=1/C14H18N2O/c1-3-16(4-2)10-11-7-8-13(17)14-12(11)6-5-9-15-14/h5-9,17H,3-4,10H2,1-2H3

SMILES: CCN(CC)Cc1ccc(c2c1cccn2)O

Synonyms:

• 8-Quinolinol, 5-[(Diethylamino)Methyl]-

5-[(Diethylamino)methyl]quinolin-8-ol

CAS: 22506-13-4

Versatile small molecule scaffold

Formula: C₁₄H₁₈N₂O

Purity: Min. 95%

Molecular weight: 230.31 g/mol

Ref: 3D-XAA50613