CAS 2251-50-5
:Pentafluorobenzoyl chloride
Description:
Pentafluorobenzoyl chloride is an organic compound characterized by its structure, which features a benzene ring substituted with five fluorine atoms and a carbonyl chloride functional group. This compound is typically a colorless to pale yellow liquid and is known for its strong reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent electrophile. Pentafluorobenzoyl chloride is highly soluble in organic solvents but is less soluble in water, reflecting its nonpolar characteristics. It is often used in organic synthesis, particularly in the preparation of fluorinated compounds and as a reagent in various chemical reactions, including acylation processes. The presence of multiple fluorine atoms imparts unique properties, such as increased lipophilicity and thermal stability, making it valuable in the development of pharmaceuticals and agrochemicals. However, it is important to handle this compound with care due to its corrosive nature and potential health hazards associated with exposure.
Formula:C7ClF5O
InChI:InChI=1S/C7ClF5O/c8-7(14)1-2(9)4(11)6(13)5(12)3(1)10
InChI key:InChIKey=MYHOHFDYWMPGJY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- 2,3,4,5,6-Pentafluorobenzoic acid chloride
- 2,3,4,5,6-Pentafluorobenzoyl chloride
- 2,3,4,5,6-Pentafluorobenzoylchloride
- Benzoyl chloride, 2,3,4,5,6-pentafluoro-
- Benzoyl chloride, pentafluoro-
- NSC 97002
- Perfluorobenzoyl chloride
- Pentafluorobenzoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pentafluorobenzoyl chloride, 98%
CAS:A reagent used for deriving primary amines. 2,3,4,5,6-Pentafluorobenzoyl chloride was used for derivatization of 5-androstenediol, testosterone, estradiol , dihydrotestosterone and estrone in a study to determine their serum levels. 2,3,4,5,6-Pentafluorobenzoyl chloride was used to derivative dimethFormula:C7ClF5OPurity:98%Color and Shape:Liquid, Clear colorless to cream to yellowMolecular weight:230.52Pentafluorobenzoyl chloride
CAS:Pentafluorobenzoyl chlorideFormula:C7ClF5OPurity:97%Color and Shape: clear. colourless liquidMolecular weight:230.52g/molPentafluorobenzoyl chloride
CAS:Pentafluorobenzoyl chlorideFormula:C7ClF5OPurity:98%Color and Shape: clear. almost colourless liquidMolecular weight:230.52g/molPentafluorobenzoyl Chloride
CAS:Formula:C7ClF5OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:230.52Pentafluorobenzoyl chloride
CAS:Formula:C7ClF5OPurity:99.0%Color and Shape:ClearMolecular weight:230.52Pentafluorobenzoyl Chloride
CAS:Controlled ProductStability Moisture Sensitive
Applications Pentafluorobenzoyl Chloride is a useful analytical reagent in the derivatization amphetamines as well as other primary amines.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Koster, E. et al.: Analyst, 127, 598 (2002);Formula:C7ClF5OColor and Shape:NeatMolecular weight:230.52





