CAS 225120-65-0

Formula: C20H24ClN5O2

InChI: InChI=1S/C20H24ClN5O2/c1-20(2,3)17-12-16(26(4)25-17)19(28)24-15(18(27)23-9-8-22)11-13-6-5-7-14(21)10-13/h5-7,10,12,15H,9,11H2,1-4H3,(H,23,27)(H,24,28)/t15-/m0/s1

InChI key: MZRVIHRERYCHBL-HNNXBMFYSA-N

SMILES: CC(C)(C)C1=NN(C(=C1)C(=O)N[C@@H](CC2=CC(=CC=C2)Cl)C(=O)NCC#N)C

Cathepsin Inhibitor 1

CAS: 225120-65-0

Formula: C₂₀H₂₄ClN₅O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 401.8899

Ref: IN-DA00BFY9

Cathepsin Inhibitor 1

CAS: 225120-65-0

Cathepsin Inhibitor 1

Formula: C₂₀H₂₄ClN₅O₂

Purity: ≥98%

Molecular weight: 401.89

Ref: 54-BUP08819

Cathepsin Inhibitor 1

CAS: 225120-65-0

Cathepsin Inhibitor 1 is a selective chemical inhibitor specifically targeting cathepsin enzymes, which is derived through synthetic processes. Cathepsins are proteolytic enzymes predominantly found in lysosomes and play a crucial role in intracellular protein degradation. By inhibiting these enzymes, Cathepsin Inhibitor 1 effectively prevents the breakdown of protein substrates, thus allowing for the regulation of various cellular processes such as apoptosis, antigen presentation, and tissue remodeling.

Formula: C₂₀H₂₄ClN₅O₂

Purity: Min. 95%

Molecular weight: 401.89 g/mol

Ref: 3D-AJA12065

Cathepsin Inhibitor 1

CAS: 225120-65-0

Cathepsin Inhibitor 1 is an inhibitor of Cathepsin (L, L2, S, K, B) with pIC50 of 7.9, 6.7, 6.0, 5.5 and 5.2, respectively.

Formula: C₂₀H₂₄ClN₅O₂

Purity: 99.78%

Color and Shape: Solid

Molecular weight: 401.89

Ref: TM-T6015