CAS 2252-37-1
:2-Bromo-6-fluorobenzoic acid
Description:
2-Bromo-6-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on a benzene ring. Specifically, the bromine atom is located at the second position and the fluorine atom at the sixth position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring. The presence of halogen atoms can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-6-fluorobenzoic acid may exhibit unique properties such as varying acidity and potential for hydrogen bonding, which can affect its behavior in chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H4BrFO2
InChI:InChI=1/C7H4BrFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11)
Synonyms:- Benzoic acid, 2-bromo-6-fluoro-
- 2-Fluoro-6-bromobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-6-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:219.012-Bromo-6-fluorobenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4BrFO2Purity:97%Molecular weight:219.012-Bromo-6-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.00792-Bromo-6-fluorobenzoic acid
CAS:2-Bromo-6-fluorobenzoic acidFormula:C7H4BrFO2Purity:98%Color and Shape: off white solidMolecular weight:219.01g/mol2-Bromo-6-fluorobenzoic acid
CAS:2-Bromo-6-fluorobenzoic acid is a carboxylate that has been used in the treatment of prostate cancer cells. It is activated by nucleophilic attack to form a reactive intermediate, which then reacts with the fluorine or chlorine substituents on DNA bases. This reaction leads to the replacement of the fluorine or chlorine with bromine, resulting in the formation of a quinazolinone. The substituted nucleotide is then recognized by enzymes, leading to cell death.
2-Bromo-6-fluorobenzoic acid has also been shown to be active against other cancer cells, such as lung and breast cancer cells.Formula:C7H4BrFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:219.01 g/mol2-Bromo-6-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.009





