CAS 2252-84-8: 1,1,1,2,2,3,3-Heptafluoropropane
Description:1,1,1,2,2,3,3-Heptafluoropropane, also known as HFC-227ea, is a fluorinated hydrocarbon with the chemical formula C3H3F7. It is a colorless gas at room temperature and has a slightly sweet odor. This compound is notable for its high stability and low toxicity, making it suitable for various applications, particularly as a refrigerant and in fire suppression systems. Its low global warming potential compared to other halocarbons has led to its use as an alternative to ozone-depleting substances. The substance has a relatively low boiling point, which allows it to exist as a gas under standard conditions. Additionally, it has a high dielectric strength, making it effective in electrical insulation applications. However, like many fluorinated compounds, it is subject to environmental regulations due to its potential impact on climate change. Overall, 1,1,1,2,2,3,3-Heptafluoropropane is characterized by its chemical stability, low toxicity, and utility in various industrial applications.
Formula:C3HF7
InChI:InChI=1S/C3HF7/c4-1(5)2(6,7)3(8,9)10/h1H
InChI key:InChIKey=UKACHOXRXFQJFN-UHFFFAOYSA-N
SMILES:FC(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,1,2,2,3,3-Heptafluoropropane
- 1,1,2,2,3,3,3-Heptafluoropropane
- 1-Hydroheptafluoropropane
- FC-227ca
- HFC 227ca
- Heptafluoropropane
- Propane, 1,1,1,2,2,3,3-heptafluoro-
- R 227ca
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Heptafluoropropane (FC-227ca) REF: 54-PC4505CAS: 2252-84-8 | 97% | 439.00 €~1,342.00 € | Thu 10 Apr 25 |
![]() | 1,1,1,2,2,3,3-Heptafluoro-Propane REF: 3D-FH80909CAS: 2252-84-8 | Min. 95% | - - - | Discontinued product |

1H-Heptafluoropropane (FC-227ca)
Ref: 54-PC4505
5g | 439.00 € | ||
25g | 712.00 € | ||
100g | 1,342.00 € |

1,1,1,2,2,3,3-Heptafluoro-Propane
Ref: 3D-FH80909
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |