CAS 225240-57-3

1-(9H-Fluoren-9-ylmethyl) 4-methyl-1,4-piperidinedicarboxylate

Description:

1-(9H-Fluoren-9-ylmethyl) 4-methyl-1,4-piperidinedicarboxylate, with the CAS number 225240-57-3, is a chemical compound characterized by its unique structure that includes a fluorenylmethyl group and a piperidine ring with two carboxylate substituents. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in medicinal chemistry and organic synthesis. The presence of the fluorenyl group may impart stability and lipophilicity, while the piperidine moiety can influence its biological activity and solubility. The diester functionality suggests that it may participate in various chemical reactions, including hydrolysis and esterification. Additionally, the compound's molecular structure may allow for interactions with biological targets, making it of interest in drug development. Overall, its characteristics, including molecular weight, solubility, and reactivity, are essential for understanding its potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₂₂H₂₃NO₄

InChI: InChI=1S/C22H23NO4/c1-22(20(24)25)10-12-23(13-11-22)21(26)27-14-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,19H,10-14H2,1H3,(H,24,25)

InChI key: InChIKey=NVLVYKWFJWQKMG-UHFFFAOYSA-N

SMILES: C(OC(=O)N1CCC(C(O)=O)(C)CC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 1-[[(9H-Fluoren-9-yl)methoxy]carbonyl]-4-methylpiperidine-4-carboxylic acid
• 1-(9H-Fluoren-9-ylmethyl) 4-methyl-1,4-piperidinedicarboxylate
• 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-methylpiperidine-4-carboxylic acid
• 1,4-Piperidinedicarboxylic acid, 4-methyl-, 1-(9H-fluoren-9-ylmethyl) ester

1-{[(9H-Fluoren-9-yl)methoxy]carbonyl}-4-methylpiperidine-4-carboxylic acid

CAS: 225240-57-3

Versatile small molecule scaffold

Formula: C₂₂H₂₃NO₄

Purity: Min. 95%

Molecular weight: 365.4 g/mol

Ref: 3D-AJA24057