CAS 2252403-56-6: 6-Fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-[4-methyl-2-(1-methylethyl)-3-pyridinyl]-4-[(2S)-2-methyl-4-(1-oxo-2-propen-1-yl)-1-piperazinyl]pyrido[2,3-d]pyrimidin-2(1H)-one
Description:6-Fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-[4-methyl-2-(1-methylethyl)-3-pyridinyl]-4-[(2S)-2-methyl-4-(1-oxo-2-propen-1-yl)-1-piperazinyl]pyrido[2,3-d]pyrimidin-2(1H)-one, with CAS number 2252403-56-6, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as fluorine, hydroxyl, and piperazine moieties. This compound exhibits potential pharmacological properties, making it of interest in medicinal chemistry. Its molecular framework suggests it may interact with biological targets, possibly influencing pathways related to various diseases. The presence of fluorine atoms typically enhances lipophilicity and metabolic stability, while the piperazine ring can contribute to receptor binding affinity. Additionally, the compound's stereochemistry, particularly the (2S) configuration, may play a crucial role in its biological activity. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, although specific biological data would be necessary to fully understand its efficacy and safety profile.
Formula:C30H30F2N6O3
InChI:InChI=1S/C30H30F2N6O3/c1-6-23(40)36-12-13-37(18(5)15-36)28-19-14-21(32)26(24-20(31)8-7-9-22(24)39)34-29(19)38(30(41)35-28)27-17(4)10-11-33-25(27)16(2)3/h6-11,14,16,18,39H,1,12-13,15H2,2-5H3/t18-/m0/s1
InChI key:InChIKey=NXQKSXLFSAEQCZ-SFHVURJKSA-N
SMILES:O=C1N=C(C=2C=C(F)C(=NC2N1C=3C(=NC=CC3C)C(C)C)C=4C(F)=CC=CC4O)N5CCN(C(=O)C=C)CC5C
- Synonyms:
- Pyrido[2,3-d]pyrimidin-2(1H)-one, 6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-[4-methyl-2-(1-methylethyl)-3-pyridinyl]-4-[(2S)-2-methyl-4-(1-oxo-2-propen-1-yl)-1-piperazinyl]-
- 6-Fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-[4-methyl-2-(1-methylethyl)-3-pyridinyl]-4-[(2S)-2-methyl-4-(1-oxo-2-propen-1-yl)-1-piperazinyl]pyrido[2,3-d]pyrimidin-2(1H)-one
- 4-((S)-4-acryloyl-2-methylpiperazin-1-yl)-6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-(2-isopropyl-4-methylpyridin-3-yl)pyrido[2,3-d]pyrimidin-2(1H)-one
- AMG-510 racemate

Ref: 54-BUP12961
1g | 1,569.00 € | ||
25mg | 241.00 € | ||
50mg | 416.00 € | ||
100mg | 638.00 € | ||
500mg | 1,270.00 € |

Ref: 4Z-S-200001
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(S)-AMG-510
Ref: TM-T22258
2mg | 37.00 € | ||
5mg | 52.00 € | ||
10mg | 85.00 € | ||
25mg | 156.00 € | ||
50mg | 274.00 € | ||
100mg | 426.00 € | ||
500mg | 938.00 € | ||
1mL*10mM (DMSO) | 77.00 € |

AMG 510 racemate
Ref: 3D-BA172506
25mg | 365.00 € | ||
50mg | 580.00 € | ||
100mg | 880.00 € | ||
250mg | 1,654.00 € |