CAS 22526-46-1
:(S)-(+)-3-Methyl-2-butylamine
Description:
(S)-(+)-3-Methyl-2-butylamine, with the CAS number 22526-46-1, is an organic compound characterized by its chiral amine structure. It features a branched alkyl chain, which contributes to its unique physical and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct amine odor. It is soluble in water and various organic solvents, making it versatile for different applications. The presence of the amine functional group allows it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. As a chiral molecule, it exhibits optical activity, meaning it can rotate plane-polarized light, which is significant in the context of pharmaceuticals and agrochemicals, where enantiomeric purity can influence biological activity. Additionally, (S)-(+)-3-Methyl-2-butylamine may be used in the synthesis of other chemical compounds or as an intermediate in organic synthesis. Safety precautions should be taken when handling this substance, as amines can be irritants and may pose health risks.
Formula:C5H13N
InChI:InChI=1/C5H13N/c1-4(2)5(3)6/h4-5H,6H2,1-3H3/t5-/m0/s1
SMILES:CC(C)[C@H](C)N
Synonyms:- (S)-(+)-2-Amino-3-methylbutane
- (S)-4-methyl-3-pentylamine
- (2S)-3-methylbutan-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-(+)-2-Amino-3-methylbutane
CAS:Formula:C5H13NPurity:95%Color and Shape:LiquidMolecular weight:87.1634(S)-(+)-2-Amino-3-methylbutane
CAS:<p>(S)-(+)-2-Amino-3-methylbutane is a chiral, optically active pyruvate. It can be used as an optical reagent to determine the configuration of an amino acid in the presence of a hydrazone or amine. The 2-amino group is attached to the C1 carbon atom and the methyl group is attached to the C4 carbon atom. Hydrogenolysis of (S)-(+)-2-amino-3-methylbutane produces ethyl pyruvate and hydrogen gas.</p>Formula:C5H13NPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:87.17 g/mol
