CAS 22536-62-5

2-chloro-5-phenylpyrimidine

Description:

2-Chloro-5-phenylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom at the second position and a phenyl group at the fifth position. This compound typically appears as a solid and is known for its role in various chemical reactions and applications, particularly in the field of medicinal chemistry and agrochemicals. Its structure contributes to its reactivity, making it a useful intermediate in the synthesis of pharmaceuticals and other biologically active compounds. The presence of the chlorine atom enhances its electrophilic properties, while the phenyl group can influence its solubility and interaction with biological targets. Additionally, 2-chloro-5-phenylpyrimidine may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and substituents. Safety and handling precautions should be observed due to its potential toxicity and reactivity. Overall, this compound is of interest for its synthetic utility and potential applications in various chemical fields.

Formula: C₁₀H₇ClN₂

InChI: InChI=1/C10H7ClN2/c11-10-12-6-9(7-13-10)8-4-2-1-3-5-8/h1-7H

SMILES: c1ccc(cc1)c1cnc(Cl)nc1

Synonyms:

• 2-Chlor-5-phenylpyrimidin
• Pyrimidine, 2-Chloro-5-Phenyl-
• 2-Chloro-5-phenylpyrimidine

2-Chloro-5-phenylpyrimidine

CAS: 22536-62-5

Formula: C₁₀H₇ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.6290

Ref: IN-DA007OC6

2-Chloro-5-phenylpyrimidine

CAS: 22536-62-5

2-Chloro-5-phenylpyrimidine

Purity: 98%

Molecular weight: 190.63g/mol

Ref: 54-OR938765

2-Chloro-5-phenylpyrimidine

CAS: 22536-62-5

Formula: C₁₀H₇ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.63

Ref: 10-F210115