CAS 22536-66-9

2-chloropyrimidine-4-carboxamide

Description:

2-Chloropyrimidine-4-carboxamide is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a chlorine atom and a carboxamide group. The presence of the chlorine atom at the second position of the pyrimidine ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxamide functional group at the fourth position enhances its solubility in polar solvents and can participate in hydrogen bonding, making it useful in various chemical reactions. This compound is often utilized as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block for more complex molecules. Additionally, its structural features may impart biological activity, making it a subject of interest in drug discovery. The compound is typically handled with standard safety precautions, as with many halogenated organic compounds, due to potential toxicity and environmental concerns.

Formula: C₅H₄ClN₃O

InChI: InChI=1/C5H4ClN3O/c6-5-8-2-1-3(9-5)4(7)10/h1-2H,(H2,7,10)

SMILES: c1cnc(Cl)nc1C(=O)N

Synonyms:

• 4-Pyrimidinecarboxamide, 2-chloro-

2-chloropyrimidine-4-carboxamide

CAS: 22536-66-9

Formula: C₅H₄ClN₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.5578

Ref: IN-DA006XOW

2-Chloropyrimidine-4-carboxamide

CAS: 22536-66-9

2-Chloropyrimidine-4-carboxamide

Purity: 97%

Color and Shape: Solid

Molecular weight: 157.56g/mol

Ref: 54-OR30544

2-Chloropyrimidine-4-carboxamide

CAS: 22536-66-9

Formula: C₅H₄ClN₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.56

Ref: 10-F237306

2-Chloropyrimidine-4-carboxamide

CAS: 22536-66-9

2-Chloropyrimidine-4-carboxamide is an activator that is a novel chemical entity of deoxyribonucleosides, phosphoramidites, ribonuclesides, and antiviral nucleosides. It has been shown to have high purity and quality. 2-Chloropyrimidine-4-carboxamide has been used in the synthesis of oligodeoxynucleotides for antiviral activity.

Formula: C₅H₄ClN₃O

Purity: Min. 95%

Molecular weight: 157.56 g/mol

Ref: 3D-NC57418