CAS 225367-66-8
:(2-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}ethoxy)acetic acid dihydrochloride
Description:
The chemical substance known as (2-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}ethoxy)acetic acid dihydrochloride, with the CAS number 225367-66-8, is a synthetic compound that belongs to the class of piperazine derivatives. It typically exhibits properties such as being a white to off-white crystalline solid, which is soluble in water and polar organic solvents due to the presence of both hydrophobic and hydrophilic functional groups. The compound features a piperazine ring, which is known for its biological activity, and a carboxylic acid group that can participate in acid-base reactions. Its dihydrochloride form indicates the presence of two hydrochloride ions, enhancing its solubility and stability in aqueous solutions. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting central nervous system disorders, owing to its potential interactions with neurotransmitter systems. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C21H26Cl2F2N2O3
InChI:InChI=1/C21H24F2N2O3.2ClH/c22-18-5-1-16(2-6-18)21(17-3-7-19(23)8-4-17)25-11-9-24(10-12-25)13-14-28-15-20(26)27;;/h1-8,21H,9-15H2,(H,26,27);2*1H
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-[2-[4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]acetic acid HCl
CAS:2-[2-[4-[Bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]acetic acid HCl (BAY-85788) is a drug which acts as a histamine receptor antagonist. It has been shown to be effective in the treatment of idiopathic urticaria. BAY-85788 has also been found to have less potential for drug interactions than other histamine receptor antagonists, and does not cause an increase in blood pressure, unlike other compounds with this activity. This compound is metabolized by cytochrome P450 enzymes and does not contain nitrogen atoms or heterocyclic rings. Experimental studies have shown that orally administered BAY-85788 is absorbed from the GI tract and eliminated unchanged in urine. Studies have also shown that BAY-85788 is active against inflammatory diseases such as atopic dermatitis, asthma, and chronic obstructive pulmonary disease (COPDFormula:C21H24F2N2O3·xHClPurity:Min. 95%Color and Shape:PowderMolecular weight:390.42 g/molRef: 3D-FB98570
Discontinued product
