CAS 2254-88-8

3,5-dichloro-1,2,4-thiadiazole

Description:

3,5-Dichloro-1,2,4-thiadiazole is a heterocyclic compound characterized by a five-membered ring containing two nitrogen atoms, one sulfur atom, and two chlorine substituents at the 3 and 5 positions. This compound is typically a white to light yellow crystalline solid, exhibiting moderate solubility in polar organic solvents. It is known for its stability under standard conditions but may decompose upon exposure to strong acids or bases. The presence of chlorine atoms contributes to its reactivity, making it useful in various chemical syntheses and applications, particularly in agrochemicals and pharmaceuticals. Additionally, the thiadiazole ring structure imparts unique electronic properties, which can influence its behavior in biological systems. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity. Overall, 3,5-dichloro-1,2,4-thiadiazole is a significant compound in organic chemistry with diverse applications due to its distinctive structural features.

Formula: C₂Cl₂N₂S

InChI: InChI=1/C2Cl2N2S/c3-1-5-2(4)7-6-1

SMILES: c1(Cl)nc(Cl)sn1

Synonyms:

• 1,2,4-Thiadiazole, 3,5-dichloro-
• 3,5-Dichloro-1,2,4-thiadiazole

3,5-Dichloro-1,2,4-thiadiazole

CAS: 2254-88-8

Formula: C₂Cl₂N₂S

Purity: 98%

Color and Shape: Liquid

Molecular weight: 155.0058

Ref: IN-DA00C21Y

3,5-Dichloro-1,2,4-thiadiazole

CAS: 2254-88-8

3,5-Dichloro-1,2,4-thiadiazole

Formula: C₂Cl₂N₂S

Purity: 97%

Color and Shape: clear. almost colourless liquid

Molecular weight: 155.01g/mol

Ref: 54-OR6558

3,5-Dichloro-1,2,4-thiadiazole

CAS: 2254-88-8

Formula: C₂Cl₂N₂S

Purity: 97.0%

Color and Shape: Liquid

Molecular weight: 155

Ref: 10-F005950