CAS 22551-26-4
:3-(Methylthio)-1,2-propanediol
Description:
3-(Methylthio)-1,2-propanediol, with the CAS number 22551-26-4, is an organic compound characterized by the presence of a methylthio group (-S-CH3) attached to a propane backbone that contains two hydroxyl (-OH) functional groups. This compound is typically a colorless to pale yellow liquid with a slightly sweet odor. It is soluble in water and various organic solvents, which makes it versatile for different applications. The presence of hydroxyl groups contributes to its potential as a humectant and solvent in cosmetic and pharmaceutical formulations. Additionally, the methylthio group may impart specific reactivity and properties, such as potential antimicrobial activity or involvement in various chemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 3-(Methylthio)-1,2-propanediol is a compound of interest in both industrial and research settings due to its unique structural features and functional properties.
Formula:C4H10O2S
InChI:InChI=1S/C4H10O2S/c1-7-3-4(6)2-5/h4-6H,2-3H2,1H3
InChI key:InChIKey=FXIHXPKPLPKPJH-UHFFFAOYSA-N
SMILES:C(CSC)(CO)O
Synonyms:- (2R)-3-(methylsulfanyl)propane-1,2-diol
- (2S)-3-(methylsulfanyl)propane-1,2-diol
- 1,2-Propanediol, 3-(methylthio)-
- 3-(Methylsulfanyl)Propane-1,2-Diol
- 3-(Methylthio)-1,2-propanediol
- 3-Methylthiopropane-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
