
CAS 225641-91-8
:4-(3,4-Difluorophenyl)-2-oxazolidinone
Description:
4-(3,4-Difluorophenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the 3,4-difluorophenyl group indicates that the compound has two fluorine substituents on a phenyl ring, which can significantly influence its chemical properties, including reactivity and polarity. This compound is typically classified as a heterocyclic organic compound and may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular conformation. As with many fluorinated compounds, the introduction of fluorine atoms can enhance metabolic stability and alter pharmacokinetic properties. Safety and handling considerations should be taken into account, as with all chemical substances, particularly in laboratory settings.
Formula:C9H7F2NO2
InChI:InChI=1S/C9H7F2NO2/c10-6-2-1-5(3-7(6)11)8-4-14-9(13)12-8/h1-3,8H,4H2,(H,12,13)
InChI key:InChIKey=AIWCAYRHYGGWKF-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1F)C2NC(=O)OC2
Synonyms:- 4-(3,4-Difluorophenyl)oxazolidin-2-one
- (+)-4-(3,4-Difluorophenyl)-oxazolidin-2-one
- 4-(3,4-Difluorophenyl)-2-oxazolidinone
- 2-Oxazolidinone, 4-(3,4-difluorophenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery