CAS 2257-69-4

4-chloro-1,2-dihydrophthalazin-1-one

Description:

4-Chloro-1,2-dihydrophthalazin-1-one is a chemical compound characterized by its unique structure, which includes a phthalazinone core with a chlorine substituent at the 4-position. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. The presence of the chlorine atom can influence its reactivity and biological activity, making it a subject of interest in various research fields. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, 4-chloro-1,2-dihydrophthalazin-1-one represents a valuable compound in the realm of synthetic organic chemistry.

Formula: C₈H₅ClN₂O

InChI: InChI=1/C8H5ClN2O/c9-7-5-3-1-2-4-6(5)8(12)11-10-7/h1-4H,(H,11,12)

SMILES: c1ccc2c(c1)c(Cl)nnc2O

Synonyms:

• 1-Chloro-3,4-dihydrophthalazin-4-one
• 4-chlorophthalazin-1(2H)-one

1-Chlorophthalazin-4-one, 98%

CAS: 2257-69-4

1-Chlorophthalazin-4-one acts as an organic and pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or

Formula: C₈H₅ClN₂O

Purity: 98%

Color and Shape: Powder, White to pale cream

Molecular weight: 180.59

Ref: 02-H27515

4-Chloro-1,2-dihydrophthalazin-1-one

CAS: 2257-69-4

Formula: C₈H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.5911

Ref: IN-DA007OB5

4-chloro-1,2-dihydrophthalazin-1-one

CAS: 2257-69-4

4-chloro-1,2-dihydrophthalazin-1-one

Formula: C₈H₅ClN₂O

Purity: 96%

Color and Shape: light brown powder

Molecular weight: 180.59g/mol

Ref: 54-OR21968

4-chloro-1-phthalazinol

CAS: 2257-69-4

Formula: C₈H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.59

Ref: 10-F310618