CAS 22575-75-3

3-(2-oxocyclododecyl)propanoic acid

Description:

3-(2-Oxocyclododecyl)propanoic acid, identified by its CAS number 22575-75-3, is an organic compound characterized by its unique structure that includes a cyclododecane ring and a propanoic acid functional group. This compound features a ketone functional group (the oxo group) attached to the cyclododecane, which contributes to its reactivity and potential applications in various chemical processes. The presence of the propanoic acid moiety indicates that it can participate in acid-base reactions and may serve as a building block in organic synthesis. The cyclododecane ring provides a rigid framework, influencing the compound's physical properties, such as melting and boiling points, solubility, and stability. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry or materials science. Its specific characteristics, including molecular weight and density, would depend on the precise arrangement of atoms and the presence of functional groups, which can affect its behavior in different chemical environments.

Formula: C₁₅H₂₆O₃

InChI: InChI=1/C15H26O3/c16-14-10-8-6-4-2-1-3-5-7-9-13(14)11-12-15(17)18/h13H,1-12H2,(H,17,18)

SMILES: C1CCCCCC(=O)C(CCCC1)CCC(=O)O

3-(2-oxocyclododecyl)propanoic acid

CAS: 22575-75-3

3-(2-oxocyclododecyl)propanoic acid

Purity: ≥95%

Molecular weight: 254.37g/mol

Ref: 54-OR21894