CAS 22578-94-5

N,N′-(1,4-Phenylenedicarbonyl)bis[glycine]

Description:

N,N′-(1,4-Phenylenedicarbonyl)bis[glycine], with the CAS number 22578-94-5, is a chemical compound characterized by its structure, which features two glycine molecules linked by a 1,4-phenylenedicarbonyl group. This compound is a type of bis-amino acid derivative, exhibiting properties typical of amino acids, such as the ability to form hydrogen bonds and participate in peptide bond formation. It is generally soluble in polar solvents due to the presence of the amino and carboxyl functional groups, which contribute to its hydrophilicity. The compound may exhibit biological activity, potentially acting as a ligand or a building block in peptide synthesis. Its structural features suggest that it could participate in various chemical reactions, including acylation and amidation, making it of interest in organic synthesis and medicinal chemistry. Additionally, the presence of the aromatic ring may impart unique electronic properties, influencing its reactivity and interaction with other molecules. Overall, N,N′-(1,4-Phenylenedicarbonyl)bis[glycine] is a versatile compound with potential applications in various fields of chemistry and biochemistry.

Formula: C₁₂H₁₂N₂O₆

InChI: InChI=1S/C12H12N2O6/c15-9(16)5-13-11(19)7-1-2-8(4-3-7)12(20)14-6-10(17)18/h1-4H,5-6H2,(H,13,19)(H,14,20)(H,15,16)(H,17,18)

InChI key: InChIKey=SNKLTOILIHVGIH-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)(=O)C1=CC=C(C(NCC(O)=O)=O)C=C1

Synonyms:

• Glycine, N,N′-(1,4-phenylenedicarbonyl)bis-
• N,N′-(1,4-Phenylenedicarbonyl)bis[glycine]
• Glycine, N,N′-terephthaloyldi-
• 2-[[4-(Carboxymethylcarbamoyl)benzoyl]amino]acetic acid
• NSC 141191

2-({4-[(Carboxymethyl)carbamoyl]phenyl}formamido)acetic acid

CAS: 22578-94-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₆

Purity: Min. 95%

Molecular weight: 280.23 g/mol

Ref: 3D-XAA57894