CAS 225791-13-9

Cis-(1S,2R)-2-Amino-Cyclopentanol Hydrochloride

Description:

Cis-(1S,2R)-2-Amino-Cyclopentanol Hydrochloride is a chiral organic compound characterized by its cyclopentane structure with an amino group and a hydroxyl group attached to the second carbon. The "cis" configuration indicates that the amino and hydroxyl groups are on the same side of the cyclopentane ring, which influences its stereochemistry and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in the synthesis of various pharmaceuticals or biologically active molecules. Its chirality suggests that it may have specific interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of both an amino and a hydroxyl group allows for potential hydrogen bonding, which can affect its reactivity and solubility. Overall, Cis-(1S,2R)-2-Amino-Cyclopentanol Hydrochloride is significant in the context of drug development and organic synthesis.

Formula: C₅H₁₂ClNO

InChI: InChI=1/C5H11NO.ClH/c6-4-2-1-3-5(4)7;/h4-5,7H,1-3,6H2;1H/t4-,5+;/m1./s1

Synonyms:

• CIS-(1S,2R)-2-Aminocyclopentanol Hydrochloride
• (1S,2R)-2-aminocyclopentanol hydrochloride
• Trans-(1S,2R)-2-aimino-cyclopentanol Hydrochloride

Cis-2-aminocyclopentanol hydrochloride

CAS: 225791-13-9

Formula: C₅H₁₂ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 137.6079

Ref: IN-DA0034M2

(1S,2R)-2-Aminocyclopentanol hydrochloride

CAS: 225791-13-9

(1S,2R)-2-Aminocyclopentanol hydrochloride

Formula: C₅H₁₁NO·ClH

Purity: 97%

Color and Shape: white solid

Molecular weight: 137.61g/mol

Ref: 54-OR307678

(1S,2R)-2-Aminocyclopentanol hydrochloride

CAS: 225791-13-9

Formula: C₅H₁₂ClNO

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 137.61

Ref: 10-F214703