CAS 22581-06-2
:3-chloro-4,6-dihydroxy-2-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]benzaldehyde
Description:
3-Chloro-4,6-dihydroxy-2-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]benzaldehyde, with CAS number 22581-06-2, is a complex organic compound characterized by its aromatic structure and multiple functional groups. The presence of hydroxyl (-OH) groups indicates its potential as a phenolic compound, which may contribute to its reactivity and solubility in polar solvents. The chloro substituent introduces halogen characteristics, potentially affecting the compound's biological activity and reactivity. The long aliphatic chain with multiple double bonds suggests that it may exhibit hydrophobic properties, influencing its interactions in biological systems. This compound may be of interest in various fields, including organic synthesis, pharmaceuticals, and agrochemicals, due to its structural complexity and potential bioactivity. Its unique combination of functional groups may also allow for diverse chemical transformations, making it a valuable compound for research and application in synthetic chemistry.
Formula:C23H31ClO3
InChI:InChI=1/C23H31ClO3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-22(26)20(14-25)18(5)21(24)23(19)27/h8,10,12,14,26-27H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ilicicolin A
CAS:<p>Ilicicolin A is a useful organic compound for research related to life sciences. The catalog number is T125289 and the CAS number is 22581-06-2.</p>Formula:C23H31ClO3Color and Shape:SolidMolecular weight:390.95
