CAS 2259-06-5
:Methyl betulinate
Description:
Methyl betulinate is an organic compound classified as a triterpenoid ester, primarily derived from the bark of birch trees. It is characterized by its molecular structure, which includes a methyl ester group attached to betulinic acid, a pentacyclic triterpene. Methyl betulinate is known for its potential biological activities, including anti-inflammatory, antioxidant, and anticancer properties, making it of interest in pharmacological research. The compound is typically a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents. Its chemical formula reflects its complex structure, which contributes to its diverse biological effects. Methyl betulinate is also studied for its applications in cosmetics and personal care products due to its skin-beneficial properties. As with many natural compounds, its efficacy and safety profile are subjects of ongoing research, highlighting the importance of understanding its mechanisms of action and potential therapeutic uses.
Formula:C31H50O3
InChI:InChI=1S/C31H50O3/c1-19(2)20-11-16-31(26(33)34-8)18-17-29(6)21(25(20)31)9-10-23-28(5)14-13-24(32)27(3,4)22(28)12-15-30(23,29)7/h20-25,32H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,28-,29+,30+,31-/m0/s1
InChI key:InChIKey=XNZIMRUZBOZIBC-JVRMVBBZSA-N
SMILES:C(OC)(=O)[C@]12[C@@]([C@@]3([C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])[H])([C@H](C(C)=C)CC2)[H]
Synonyms:- 1H-Cyclopenta[a]chrysene, lup-20(29)-en-28-oic acid deriv.
- Betulinic acid methyl ester
- Lup-20(29)-en-28-oic acid, 3-hydroxy-, methyl ester, (3beta)-
- Lup-20(29)-en-28-oic acid, 3β-hydroxy-, methyl ester
- Lup-20(30)-en-28-oic acid, 3β-hydroxy-, methyl ester
- Mairin, methyl ester
- Methyl (3Beta)-3-Hydroxylup-20(29)-En-28-Oate
- Methyl 3-Hydroxylup-20(29)-En-28-Oate
- Methyl betulate
- Methyl betulinate
- Nsc 152532
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Betulinic acid methylester
CAS:Betulinic acid methylester analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C31H50O3Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:470.74Betulinic acid methyl ester
CAS:Betulinic acid methyl ester inhibits chloroquine-resistant malaria and B16 2F2 cell growth by apoptosis.Formula:C31H50O3Purity:99.12%Color and Shape:SolidMolecular weight:470.74Betulinic acid methyl ester
CAS:Betulinic acid methyl ester is a synthetic chemical compound, which is a derivative of betulinic acid, primarily sourced from the bark of birch trees. This compound retains the influential bioactive properties of its precursor, acting primarily through the induction of apoptosis in cancerous cells by modulating mitochondrial pathways. Its ability to disrupt cancer cell proliferation and promote programmed cell death makes it a subject of interest in cancer research.Formula:C31H50O3Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:470.73 g/mol




