CAS 2259-85-0
:Decanohydroxamic acid
Description:
Decanohydroxamic acid, with the CAS number 2259-85-0, is an organic compound characterized by its hydroxamic acid functional group (-C(=O)N(OH)R) attached to a decanoic acid chain. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxamic group, which can form hydrogen bonds. The decanoic acid moiety contributes to its hydrophobic characteristics, making it amphiphilic. Decanohydroxamic acid is known for its chelating properties, particularly with metal ions, which makes it useful in various applications, including analytical chemistry and metal extraction processes. Additionally, it may exhibit biological activity, potentially influencing its use in pharmaceuticals or agrochemicals. The stability of the compound can be influenced by pH and temperature, and it may undergo hydrolysis under certain conditions. Overall, decanohydroxamic acid is a versatile compound with significant implications in both industrial and research settings.
Formula:C10H21NO2
InChI:InChI=1S/C10H21NO2/c1-2-3-4-5-6-7-8-9-10(12)11-13/h13H,2-9H2,1H3,(H,11,12)
InChI key:InChIKey=QZXOLBPUAUOQFB-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C(NO)=O
Synonyms:- Decanamide, N-hydroxy-
- Caprinohydroxamic acid
- N-Hydroxydecanamide
- n-Decanohydroxamic acid
- Decanohydroxamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
n-Decanohydroxamic acid
CAS:n-Decanohydroxamic acid is a biochemical.Formula:C10H21NO2Color and Shape:SolidMolecular weight:187.28N-Hydroxydecanamide
CAS:N-Hydroxydecanamide is a hydroxamic acid derivative that is used as an antimicrobial agent. It has been shown to inhibit the replication of viruses by binding to their RNA and DNA, inhibiting protein synthesis, and causing cell death. N-Hydroxydecanamide also inhibits the growth of bacteria. This chemical can be extracted from fatty acids, aliphatic hydrocarbons and pharmaceutical preparations. It has a functional group that causes it to bind to organic molecules and adsorb on surfaces.Formula:C10H21NO2Purity:Min. 95%Molecular weight:187.28 g/mol

