CAS 226-36-8: Dibenz[a,h]acridine (purity)
Description:Dibenz[a,h]acridine is a polycyclic aromatic hydrocarbon characterized by its complex fused ring structure, which consists of multiple aromatic rings. It is known for its planar geometry, contributing to its stability and potential for strong π-π stacking interactions. This compound is typically a solid at room temperature and exhibits a high melting point. Dibenz[a,h]acridine is insoluble in water but soluble in organic solvents such as benzene and toluene, which is common for many polycyclic aromatic hydrocarbons. It is often studied for its photophysical properties, including fluorescence and phosphorescence, making it of interest in fields such as organic electronics and materials science. Additionally, dibenz[a,h]acridine has been investigated for its potential mutagenic and carcinogenic properties, as many compounds in this class are known to pose health risks. Due to these characteristics, dibenz[a,h]acridine is handled with caution in laboratory settings, and its purity is crucial for accurate scientific research and applications.
Formula:C21H13N
InChI:InChI=1S/C21H13N/c1-3-7-17-14(5-1)11-12-20-19(17)13-16-10-9-15-6-2-4-8-18(15)21(16)22-20/h1-13H
InChI key:InChIKey=JNCSIWAONQTVCF-UHFFFAOYSA-N
SMILES:N=1C2=CC=C3C=CC=CC3=C2C=C4C=CC=5C=CC=CC5C14

Dibenz[a,h]acridine 10 µg/mL in Cyclohexane
Ref: 04-L20694200CY
10ml | 92.00 € |

EPA Method 610 Additions PAH Mixture 445 5-100 µg/mL in Acetonitrile
Ref: 04-A50000445AL
1ml | To inquire |

EPA Method 610 Additions PAH Mixture 446 1000 µg/mL in Dichloromethane
Controlled ProductRef: 04-A50000446DI
1ml | 233.00 € |

Dibenz[a,h]acridine
Controlled ProductRef: TR-D416900
10mg | 291.00 € | ||
50mg | 1,110.00 € | ||
100mg | 1,952.00 € |

Dibenz[a,h]acridine
Ref: 3D-FD21520
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |