CAS 22600-86-8: Tetrahydro-5-methyl-3-furanmethanol

Description:Tetrahydro-5-methyl-3-furanmethanol, with the CAS number 22600-86-8, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a tetrahydrofuran moiety, indicating that it has undergone hydrogenation, resulting in a saturated cyclic ether. The presence of a hydroxymethyl group (-CH2OH) contributes to its reactivity and solubility in polar solvents, making it useful in various chemical applications. It is typically a colorless to pale yellow liquid with a sweet, pleasant odor. The compound is of interest in the fields of organic synthesis and fragrance chemistry due to its potential as a building block for more complex molecules. Additionally, its structural features may impart certain biological activities, although specific biological properties would require further investigation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₆H₁₂O₂

InChI:InChI=1S/C6H12O2/c1-5-2-6(3-7)4-8-5/h5-7H,2-4H2,1H3

InChI key:InChIKey=NQIAQBVYGDADLH-UHFFFAOYSA-N

SMILES:OCC1COC(C)C1