
CAS 226072-63-5
:Solimastat
Description:
Solimastat, with the CAS number 226072-63-5, is a synthetic compound that functions primarily as a selective inhibitor of the enzyme matrix metalloproteinase (MMP). MMPs are involved in the degradation of extracellular matrix components and play a significant role in various physiological and pathological processes, including tissue remodeling and cancer metastasis. Solimastat has been investigated for its potential therapeutic applications, particularly in oncology, due to its ability to inhibit tumor growth and metastasis by disrupting the tumor microenvironment. The compound is characterized by its specific binding affinity to MMPs, which allows it to modulate their activity effectively. Additionally, Solimastat's pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are crucial for determining its efficacy and safety profile in clinical settings. As research continues, the full therapeutic potential and mechanisms of action of Solimastat are being explored, particularly in the context of cancer treatment and other diseases associated with MMP dysregulation.
Formula:C20H32N4O5
InChI:InChI=1S/C20H32N4O5/c1-12(2)11-13(15(29-6)18(26)24-28)17(25)23-16(20(3,4)5)19(27)22-14-9-7-8-10-21-14/h7-10,12-13,15-16,28H,11H2,1-6H3,(H,23,25)(H,24,26)(H,21,22,27)/t13-,15+,16-/m1/s1
InChI key:InChIKey=WORSVFBVUCBRIP-VNQPRFMTSA-N
SMILES:[C@@H]([C@@H](C(NO)=O)OC)(C(N[C@H](C(NC1=CC=CC=N1)=O)[C@](C)(C)C)=O)CC(C)C
Synonyms:- Butanediamide, N1-[(1S)-2,2-dimethyl-1-[(2-pyridinylamino)carbonyl]propyl]-N4-hydroxy-3-methoxy-2-(2-methylpropyl)-, (2R,3S)-
- BB 3644
- (2R,3S)-N1-[(1S)-2,2-Dimethyl-1-[(2-pyridinylamino)carbonyl]propyl]-N4-hydroxy-3-methoxy-2-(2-methylpropyl)butanediamide
- Solimastat
- Butanediamide, N4-[(1S)-2,2-dimethyl-1-[(2-pyridinylamino)carbonyl]propyl]-N1-hydroxy-2-methoxy-3-(2-methylpropyl)-, (2S,3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Solimastat
CAS:Solimastat: oral MMPI, >10x active than marimastat, inhibits cell-bound TNF-alpha processing.Formula:C20H32N4O5Color and Shape:SolidMolecular weight:408.49
