CAS 226073-90-1
:6-Chloro-7-quinolinamine
Description:
6-Chloro-7-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chlorine atom at the 6-position and an amino group at the 7-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the amino group, while its aromatic nature allows for potential interactions with various biological targets. It may participate in hydrogen bonding and π-π stacking interactions, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's reactivity and biological activity, potentially enhancing its pharmacological profile. Additionally, 6-Chloro-7-quinolinamine may serve as a precursor or intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. As with many nitrogen-containing heterocycles, it may also exhibit fluorescence properties, which can be useful in various analytical applications. Safety and handling precautions should be observed due to its potential biological activity and reactivity.
Formula:C9H7ClN2
InChI:InChI=1S/C9H7ClN2/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h1-5H,11H2
InChI key:InChIKey=RMNRIJKZCPHZJF-UHFFFAOYSA-N
SMILES:ClC1=CC2=C(C=C1N)N=CC=C2
Synonyms:- 6-Chloro-7-quinolinamine
- 7-Quinolinamine, 6-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
