CymitQuimica logo

CAS 226085-17-2

:

tert-Butyl3-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate

Description:
Tert-Butyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrrolopyridine core. This compound features a tert-butyl ester group, which enhances its lipophilicity and stability. The presence of a bromine atom at the 3-position of the pyrrolopyridine ring contributes to its reactivity, making it a potential candidate for various chemical transformations. The carboxylate functional group is significant for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is likely to exhibit interesting biological activities due to its heterocyclic structure, which is common in many bioactive molecules. Additionally, its solubility and stability in organic solvents make it suitable for various synthetic applications. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts. Overall, tert-Butyl 3-bromo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate represents a valuable compound in the field of organic synthesis and drug development.
Formula:C12H13BrN2O2
InChI:InChI=1S/C12H13BrN2O2/c1-12(2,3)17-11(16)15-7-9(13)8-5-4-6-14-10(8)15/h4-7H,1-3H3
InChI key:LRMPSYYFDWATPN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C=C(C2=C1N=CC=C2)Br
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-1-carboxylicacid,3-bromo-,1,1-dimethylethylester
Found 4 products.