CAS 22612-27-7

(2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one

Description:

The chemical substance known as "(2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one," with the CAS number 22612-27-7, is a steroid derivative characterized by multiple hydroxyl groups and a specific configuration at various carbon positions. This compound features a cholestane backbone, which is typical of steroids, and includes a conjugated diene system, contributing to its reactivity and potential biological activity. The presence of five hydroxyl groups indicates a high degree of polarity, which may influence its solubility in water and organic solvents. The specific stereochemistry, denoted by the β and R designations, suggests that the compound may exhibit unique interactions with biological systems, potentially affecting its pharmacological properties. Such compounds are often studied for their roles in biological processes, including hormone synthesis and cellular signaling. Overall, this substance exemplifies the complexity and diversity of steroid chemistry, with implications for both medicinal chemistry and biochemistry.

Formula: C₂₇H₄₂O₆

InChI: InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)22-7-6-16-15-12-19(28)18-13-20(29)21(30)14-26(18,4)17(15)8-11-25(16,22)3/h6,18,20-23,29-33H,7-14H2,1-5H3/t18-,20+,21-,22-,23+,25-,26+,27+/m0/s1

InChI key: InChIKey=AEFMTBQZWMUASH-IILZZRPCSA-N

SMILES: C[C@@]12C3=C(C=4[C@](C)(CC3)[C@@]([C@@]([C@@H](CCC(C)(C)O)O)(C)O)(CC4)[H])CC(=O)[C@@]1(C[C@@H](O)[C@@H](O)C2)[H]

Synonyms:

• Cholesta-8,14-dien-6-one, 2,3,20,22,25-pentahydroxy-, (2β,3β,5β,22R)-
• (2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one
• Podecdysone B
• 5β-Cholesta-8,14-dien-6-one, 2β,3β,20,22,25-pentahydroxy-, (22R)-

Podecdysone B

CAS: 22612-27-7

Podecdysone B analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₂₇H₄₂O₆

Purity: (HPLC) ≥98%

Color and Shape: Powder

Molecular weight: 462.63

Ref: 11-3590S

Podecdysone B

CAS: 22612-27-7

Podecdysone B is a natural product(phytoecdysone) isolated from Cyanotis arachnoidea.

Formula: C₂₇H₄₂O₆

Purity: 98.39%

Color and Shape: Solid

Molecular weight: 462.62

Ref: TM-T13822

Podecdysone B

CAS: 22612-27-7

Podecdysone B

Purity: ≥98%

Molecular weight: 462.62g/mol

Ref: 54-BUP04837

Podecdysone B

CAS: 22612-27-7

Formula: C₂₇H₄₂O₆

Molecular weight: 462.63

Ref: 7W-GY5905

Podecdysone B

CAS: 22612-27-7

Formula: C₂₇H₄₂O₆

Purity: 95%~99%

Molecular weight: 462.627

Ref: BP-BP2070

Podecdysone B

CAS: 22612-27-7

Podecdysone B is a phytoecdysteroid, which is a type of natural compound found in various plant species. These compounds are analogues of insect molting hormones and are primarily sourced from plants like spinach, quinoa, and a variety of ferns. The mode of action of Podecdysone B involves interacting with ecdysteroid receptors in cells, leading to the activation of pathways that regulate growth and development.

Formula: C₂₇H₄₂O₆

Purity: Min. 95%

Molecular weight: 462.6 g/mol

Ref: 3D-XAA61227