CAS 22612-27-7
:(2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one
Description:
The chemical substance known as "(2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one," with the CAS number 22612-27-7, is a steroid derivative characterized by multiple hydroxyl groups and a specific configuration at various carbon positions. This compound features a cholestane backbone, which is typical of steroids, and includes a conjugated diene system, contributing to its reactivity and potential biological activity. The presence of five hydroxyl groups indicates a high degree of polarity, which may influence its solubility in water and organic solvents. The specific stereochemistry, denoted by the β and R designations, suggests that the compound may exhibit unique interactions with biological systems, potentially affecting its pharmacological properties. Such compounds are often studied for their roles in biological processes, including hormone synthesis and cellular signaling. Overall, this substance exemplifies the complexity and diversity of steroid chemistry, with implications for both medicinal chemistry and biochemistry.
Formula:C27H42O6
InChI:InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)22-7-6-16-15-12-19(28)18-13-20(29)21(30)14-26(18,4)17(15)8-11-25(16,22)3/h6,18,20-23,29-33H,7-14H2,1-5H3/t18-,20+,21-,22-,23+,25-,26+,27+/m0/s1
InChI key:InChIKey=AEFMTBQZWMUASH-IILZZRPCSA-N
SMILES:C[C@@]12C3=C(C=4[C@](C)(CC3)[C@@]([C@@]([C@@H](CCC(C)(C)O)O)(C)O)(CC4)[H])CC(=O)[C@@]1(C[C@@H](O)[C@@H](O)C2)[H]
Synonyms:- Cholesta-8,14-dien-6-one, 2,3,20,22,25-pentahydroxy-, (2β,3β,5β,22R)-
- (2β,3β,5β,22R)-2,3,20,22,25-Pentahydroxycholesta-8,14-dien-6-one
- Podecdysone B
- 5β-Cholesta-8,14-dien-6-one, 2β,3β,20,22,25-pentahydroxy-, (22R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Podecdysone B
CAS:Podecdysone B analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C27H42O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:462.63Podecdysone B
CAS:Podecdysone B is a natural product(phytoecdysone) isolated from Cyanotis arachnoidea.Formula:C27H42O6Purity:98.39%Color and Shape:SolidMolecular weight:462.62Ref: TM-T13822
1mg70.00€5mg153.00€10mg219.00€25mg366.00€50mg522.00€100mg712.00€1mL*10mM (DMSO)159.00€Podecdysone B
CAS:Podecdysone B is a phytoecdysteroid, which is a type of natural compound found in various plant species. These compounds are analogues of insect molting hormones and are primarily sourced from plants like spinach, quinoa, and a variety of ferns. The mode of action of Podecdysone B involves interacting with ecdysteroid receptors in cells, leading to the activation of pathways that regulate growth and development.
Formula:C27H42O6Purity:Min. 95%Molecular weight:462.6 g/mol





