CymitQuimica logo

CAS 22612-93-7

:

9,10-dihydro-9,10-ethanoanthracene-11,12-dione

Description:
9,10-Dihydro-9,10-ethanoanthracene-11,12-dione, with the CAS number 22612-93-7, is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs). It features a fused ring system that includes a dione functional group, which contributes to its reactivity and potential applications in organic synthesis. The compound is characterized by its relatively stable structure, but it can undergo various chemical reactions, such as reduction and oxidation, due to the presence of the carbonyl groups. Its physical properties, such as solubility and melting point, can vary depending on the solvent and conditions used. This compound is of interest in fields such as materials science and organic electronics, where its unique electronic properties may be exploited. Additionally, like many PAHs, it may exhibit fluorescence and has implications in environmental chemistry due to its potential formation from combustion processes. Safety data should be consulted, as PAHs are often associated with toxicity and environmental persistence.
Formula:C16H10O2
InChI:InChI=1/C16H10O2/c17-15-13-9-5-1-2-6-10(9)14(16(15)18)12-8-4-3-7-11(12)13/h1-8,13-14H
InChI key:QETMKDPWKAPGCN-UHFFFAOYSA-N
SMILES:C1=CC=C2C3C4=CC=CC=C4C(C2=C1)C(=O)C3=O
Synonyms:
  • 9,10-dihydro-9,10-ethanoanthracene-11,12-dione
  • 9,10-Ethanoanthracene-11,12-dione, 9,10-dihydro-
  • See more synonyms
Found 2 products.