CAS 22614-72-8

7-Chloro-2-hydroxyquinoline

Description:

7-Chloro-2-hydroxyquinoline, with the CAS number 22614-72-8, is an organic compound that belongs to the class of quinoline derivatives. It features a chlorine atom and a hydroxyl group attached to the quinoline ring, which contributes to its unique chemical properties. This compound is typically characterized by its solid state at room temperature and exhibits a pale yellow to light brown appearance. It is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The presence of the hydroxyl group enhances its solubility in polar solvents, while the chlorine atom can influence its reactivity and interaction with biological targets. Additionally, 7-Chloro-2-hydroxyquinoline may participate in various chemical reactions, such as nucleophilic substitutions and complexation with metal ions, which can be relevant in coordination chemistry. Overall, its structural features and functional groups contribute to its versatility in both synthetic and medicinal chemistry applications.

Formula: C₉H₆ClNO

InChI: InChI=1/C9H6ClNO/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1-5H,(H,11,12)

SMILES: c1cc(cc2c1ccc(n2)O)Cl

Synonyms:

• 7-Chloro-2-quinolone
• 7-Chloro-1H-quinolin-2-one
• 7-chloroquinolin-2(1H)-one

7-Chloro-2-hydroxyquinoline

CAS: 22614-72-8

Formula: C₉H₆ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.6030

Ref: IN-DA00BBZB

7-Chloro-1H-quinolin-2-one

CAS: 22614-72-8

7-Chloro-1H-quinolin-2-one

Purity: 97%

Molecular weight: 179.60304g/mol

Ref: 54-OR2149

7-Chloro-2-hydroxyquinoline

CAS: 22614-72-8

Formula: C₉H₆ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.6

Ref: 10-F077237