CAS 22624-54-0
:diethyl 2,2'-(1,3-dithietane-2,4-diylidene)bis(cy
Description:
Diethyl 2,2'-(1,3-dithietane-2,4-diylidene)bis(cy) is a chemical compound characterized by its unique structure, which includes a dithietane moiety. This compound features two ethyl groups attached to a central dithietane framework, which consists of sulfur atoms integrated into a cyclic structure. The presence of sulfur contributes to its potential reactivity and properties, such as increased electron density and the ability to participate in various chemical reactions. The compound may exhibit interesting optical and electronic properties due to its conjugated system, making it of interest in materials science and organic synthesis. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many sulfur-containing compounds, it may have specific applications in organic chemistry, particularly in the synthesis of more complex molecules or as intermediates in various chemical processes. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe usage in laboratory settings.
Formula:C12H10N2O4S2
InChI:InChI=1/C12H10N2O4S2/c1-3-17-9(15)7(5-13)11-19-12(20-11)8(6-14)10(16)18-4-2/h3-4H2,1-2H3/b11-7-,12-8+
Synonyms:- Diethyl 2,2-(1,3-dithietane-2,4-diylidene)bis(cyanoacetate)
- diethyl (2E,2'E)-2,2'-(1,3-dithietane-2,4-diylidene)bis(cyanoethanoate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Diethyl 2,2′-(1,3-dithietane-2,4-diylidene)bis(cyanoacetate)
CAS:Formula:C12H10N2O4S2Molecular weight:310.3488Diethyl 2,2'-(1,3-Dithietane-2,4-diylidene)bis(cyanoacetate)
CAS:Controlled ProductApplications Diethyl 2,2'-(1,3-Dithietane-2,4-diylidene)bis(cyanoacetate) is used in the synthesis of Olanzapine Thiohydroxymethylidene Impurity (O253795), which is a serotonin (5-HT2) and dopamine (D1/D2) receptor antagonist with anticholinergic activity.
References Moore, N.A., et al.: Curr. Opin Invest. Drugs, 2, 281 (1993), Baldwin, D.S. and Montgomery, S.A.: Int. Clin. Psychopharmacol., 10, 239 (1995), Tohen, M., et al.: Am. J. Psychiatry, 156, 702 (1999)Formula:C12H10N2O4S2Color and Shape:NeatMolecular weight:310.35

