CAS 226259-48-9

Benzo[b]thiophene-5-carboxylic acid, 2,3-dihydro-, 1,1-dioxide

Description:

Benzo[b]thiophene-5-carboxylic acid, 2,3-dihydro-, 1,1-dioxide, identified by CAS number 226259-48-9, is a heterocyclic organic compound characterized by its fused benzene and thiophene rings. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the 1,1-dioxide indicates that it has two oxygen atoms bonded to the sulfur atom in the thiophene ring, enhancing its stability and influencing its chemical behavior. Typically, compounds of this nature exhibit properties such as moderate solubility in polar solvents and potential applications in organic synthesis, pharmaceuticals, and materials science. The structural features of benzo[b]thiophene derivatives often lead to interesting electronic properties, making them suitable for use in organic electronics and as building blocks in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, warranting further investigation into its potential therapeutic applications.

Formula: C₉H₈O₄S

InChI: InChI=1S/C9H8O4S/c10-9(11)7-1-2-8-6(5-7)3-4-14(8,12)13/h1-2,5H,3-4H2,(H,10,11)

InChI key: InChIKey=MPRPXLMHIKCBAC-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(=CC(C(O)=O)=CC2)CC1

Synonyms:

• Benzo[b]thiophene-5-carboxylic acid, 2,3-dihydro-, 1,1-dioxide
• 1,1-Dioxo-2,3-dihydro-1λ6-benzothiophene-5-carboxylic acid

2,​3-​Dihydro-benzo[b]​thiophene-​5-​carboxylic acid 1,​1-​dioxide

CAS: 226259-48-9

Versatile small molecule scaffold

Formula: C₉H₈O₄S

Purity: Min. 95%

Molecular weight: 212.22 g/mol

Ref: 3D-BJA25948