CAS 22631-59-0
:3,5-dichloro-4-methoxybenzohydrazide
Description:
3,5-Dichloro-4-methoxybenzohydrazide is an organic compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with a substituted aromatic carboxylic acid. This compound features a benzene ring with two chlorine atoms and a methoxy group attached, contributing to its unique chemical properties. The presence of the dichloro substituents enhances its reactivity and potential applications in various chemical reactions, including as a building block in the synthesis of pharmaceuticals and agrochemicals. The methoxy group can influence the compound's solubility and polarity, affecting its behavior in different solvents. Additionally, the hydrazide moiety may exhibit biological activity, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may require specific handling and storage conditions due to its chemical nature. Safety data sheets should be consulted for information on toxicity and safe handling practices. Overall, 3,5-dichloro-4-methoxybenzohydrazide is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H8Cl2N2O2
InChI:InChI=1/C8H8Cl2N2O2/c1-14-7-5(9)2-4(3-6(7)10)8(13)12-11/h2-3H,11H2,1H3,(H,12,13)
SMILES:COc1c(cc(cc1Cl)C(=NN)O)Cl
Synonyms:- Benzoic Acid, 3,5-Dichloro-4-Methoxy-, Hydrazide
- 3,5-Dichloro-4-methoxybenzohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,5-Dichloro-4-methoxybenzenecarbohydrazide
CAS:Formula:C8H8Cl2N2O2Color and Shape:SolidMolecular weight:235.06733,5-Dichloro-4-methoxybenzhydrazide
CAS:<p>3,5-Dichloro-4-methoxybenzhydrazide</p>Molecular weight:235.07g/mol

