
CAS 22636-79-9
:3-(dimethylamino)propanehydrazide (non-preferred name)
Description:
3-(Dimethylamino)propanehydrazide, also known by its CAS number 22636-79-9, is an organic compound characterized by the presence of a hydrazide functional group attached to a propyl chain that includes a dimethylamino substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents such as water and alcohols, which is indicative of its hydrophilic nature due to the presence of the hydrazide and amine groups. The dimethylamino group contributes to its basicity and potential reactivity, making it useful in various chemical synthesis applications, including as a building block in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards.
Formula:C5H13N3O
InChI:InChI=1/C5H13N3O/c1-8(2)4-3-5(9)7-6/h3-4,6H2,1-2H3,(H,7,9)
SMILES:CN(C)CCC(=NN)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(Dimethylamino)propanohydrazide
CAS:3-(Dimethylamino)propanohydrazide is a potent inhibitor of lipoxygenases in the nanomolar range. It has been shown to inhibit a number of lipoxygenases, including 5-lipoxygenase and 15-lipoxygenase, which are enzymes that catalyze the conversion of arachidonic acid to leukotrienes. 3-(Dimethylamino)propanohydrazide was also found to be an efficient inhibitor of acylhydrazone formation and is being used as a lead compound for drug discovery. This compound has been shown to be potent inhibitors of regulatory enzymes in the lung disease screening reaction mixtures, such as those that regulate inflammation or blood pressure.Formula:C5H13N3OPurity:Min. 95%Molecular weight:131.18 g/mol

